Organic Acids
OCc1ccccc1)c1ccc2ccccc2c1 | 500mg | 761737045](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502479092.JPG-250.jpg)
eMolecules 338731-59-2 | (S)-Benzyloxycarbonylamino-naphthalen-2-yl-acetic acid | J&W PharmLab LLC335.359 | C20H17NO4 | 96.000 | OC(=O)[C@@H](NC(=O)OCc1ccccc1)c1ccc2ccccc2c1 | 500mg | 761737045
(S)-Benzyloxycarbonylamino-naphthalen-2-yl-acetic acid | J&W PharmLab LLC | 338731-59-2335.359 | C20H17NO4 | 96.000 | OC(=O)[C@@H](NC(=O)OCc1ccccc1)c1ccc2ccccc2c1 | 500mg | 761737045
eMolecules 77-92-9 | Citric Acid, anhydrous, USP | Oakwood Chemicals192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 25g | 480153417
Citric Acid, anhydrous, USP | Oakwood Chemicals | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 25g | 480153417
(CCCC)c1ccncn1 | 0.25g | 290667610](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502461505.JPG-250.jpg)
eMolecules 332133-92-3 | 4-(TRIBUTYLSTANNYL)PYRIMIDINE | AstaTech | MFCD13190287 | 369.140 | C16H30N2Sn | 95.000 | CCCC[Sn](CCCC)(CCCC)c1ccncn1 | 0.25g | 290667610
4-(TRIBUTYLSTANNYL)PYRIMIDINE | AstaTech | 332133-92-3 | MFCD13190287 | 369.140 | C16H30N2Sn | 95.000 | CCCC[Sn](CCCC)(CCCC)c1ccncn1 | 0.25g | 290667610
Medchemexpress LLC Citric acid-d4-1 | 77-92-9 | 196.15 | 5 MG
Citric acid-d4-1 is a deuterated labeled version of Citric acid that acts as a natural preservative and food tartness enhancer. It has been observed to induce apoptosis and cell cycle arrest in HaCaT cells and can lead to oxidative damage of the liver by reducing antioxidative enzyme activities. This compound is also widely used across various industries as an acidulant, emulsifier, sequestrant, and buffering agent.
- Deuterated labeled compound
- Can be used as a tracer
- Can be used as an internal standard for quantitative analysis by NMR, GC-MS, or LC-MS
- Stable heavy isotopes incorporated into drug molecules for quantitation during drug development
- Deuteration has potential to affect the pharmacokinetic and metabolic profiles of drugs
=O)C(F)(F)F | 100mg | 784553535](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473192.JPG-250.jpg)
eMolecules 835629-56-6 | (3R)-4,4,4-trifluoro-3-methylbutanoic acid | Synthonix | MFCD30337934 | 156.104 | C5H7F3O2 | 99.000 | C[C@H](CC(O)=O)C(F)(F)F | 100mg | 784553535
(3R)-4,4,4-trifluoro-3-methylbutanoic acid | Synthonix | 835629-56-6 | MFCD30337934 | 156.104 | C5H7F3O2 | 99.000 | C[C@H](CC(O)=O)C(F)(F)F | 100mg | 784553535
eMolecules 13211-32-0 | 2-(tert-Butoxy)acetic acid | Ambeed | MFCD03452738 | 132.159 | C6H12O3 | 95.000 | CC(C)(C)OCC(O)=O | 1g | 552548834
2-(tert-Butoxy)acetic acid | Ambeed | 13211-32-0 | MFCD03452738 | 132.159 | C6H12O3 | 95.000 | CC(C)(C)OCC(O)=O | 1g | 552548834
eMolecules 5445-51-2 | Cyclobutane-1,1-dicarboxylic acid | Ambeed | MFCD00001325 | 144.126 | C6H8O4 | 98.000 | OC(=O)C1(CCC1)C(O)=O | 10g | 552682464
Cyclobutane-1,1-dicarboxylic acid | Ambeed | 5445-51-2 | MFCD00001325 | 144.126 | C6H8O4 | 98.000 | OC(=O)C1(CCC1)C(O)=O | 10g | 552682464
eMolecules 3095-95-2 | Diethylphosphonoacetic acid | Ambeed | MFCD00192032 | 196.139 | C6H13O5P | 98.000 | CCOP(=O)(CC(O)=O)OCC | 1g | 490551034
Diethylphosphonoacetic acid | Ambeed | 3095-95-2 | MFCD00192032 | 196.139 | C6H13O5P | 98.000 | CCOP(=O)(CC(O)=O)OCC | 1g | 490551034
eMolecules 746630-77-3 | AstaTech | (2-PROPOXYPHENOXY)ACETIC ACID | 0.1g | 721428443 | E86977 | 95 | MFCD05270006 | 210.229 | C11H14O4
AstaTech | (2-PROPOXYPHENOXY)ACETIC ACID | 0.1g | 721428443 | E86977 | 95.000 | 746630-77-3 | MFCD05270006 | 210.229 | C11H14O4
eMolecules 201740-78-5 | Medchem Express | Boc-Ala-OH-1-13C | 50mg | 721611305 | HY-41121S | MFCD00083884 | 190.203 | C8H15NO4
Ambeed | Boc-His(Tos)-OH | 5g | 552680896 | A259776 | 35899-43-5 | MFCD00065967 | 409.460 | C18H23N3O6S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 77-92-9 | Citric Acid, anhydrous, USP | Oakwood Chemicals192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 1kg | 480153420
Citric Acid, anhydrous, USP | Oakwood Chemicals | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 1kg | 480153420
Medchemexpress LLC Citric acid-13C3 | 302912-06-7 | 973254 | 195.10 | 5 MG
Citric acid-13C3 is the 13C-labeled Citric acid. It is a natural preservative and food tartness enhancer. Citric acid induces apoptosis and cell cycle arrest at G2/M phase and S phase in HaCaT cells. Citric acid can cause oxidative damage of the liver by decreasing antioxidative enzyme activities. It is also used as an acidulant, emulsifier, sequestrant, and buffering agent across various industries.
- 13C-labeled citric acid
- Natural preservative
- Food tartness enhancer
- Induces apoptosis and cell cycle arrest
- Functions as an acidulant, emulsifier, sequestrant, and buffering agent
- Can be used as a tracer
- Can be used as an internal standard for quantitative analysis by NMR, GC-MS, or LC-MS
![eMolecules 711-02-4 | Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | MFCD00498000 | 198.218 | C10H14O4](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502515657.JPG-250.jpg)
eMolecules 711-02-4 | Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | MFCD00498000 | 198.218 | C10H14O4
Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | 711-02-4 | MFCD00498000 | 198.218 | C10H14O4